C29H53NO6 — CID 145467365
(3R,5S,6R,9R,11S,12R,13S,14R)-6-[(2S,4S,6R)-4,6-dimethyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-10-imino-3,5,7,7,9,11,13-heptamethyl-oxacyclotetradecan-2-one (PubChem CID 145467365) has the molecular formula C29H53NO6 and a molecular weight of 511.74 g/mol. Its IUPAC name is (3R,5S,6R,9R,11S,12R,13S,14R)-6-[(2S,4S,6R)-4,6-dimethyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-10-imino-3,5,7,7,9,11,13-heptamethyl-oxacyclotetradecan-2-one.
| Compound Name | (3R,5S,6R,9R,11S,12R,13S,14R)-6-[(2S,4S,6R)-4,6-dimethyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-10-imino-3,5,7,7,9,11,13-heptamethyl-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 145467365 |
| Molecular Formula | C29H53NO6 |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.39 |
| IUPAC Name | (3R,5S,6R,9R,11S,12R,13S,14R)-6-[(2S,4S,6R)-4,6-dimethyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-10-imino-3,5,7,7,9,11,13-heptamethyl-oxacyclotetradecan-2-one |
| SMILES | [H]/N=C1/[C@H](C)CC(C)(C)[C@H](O[C@H]2C[C@@H](C)C[C@@H](C)O2)[C@@H](C)C[C@@H](C)C(=O)O[C@H](CC)[C@@](C)(O)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C29H53NO6/c1-11-22-29(10,33)25(31)21(7)24(30)19(5)15-28(8,9)26(17(3)14-18(4)27(32)35-22)36-23-13-16(2)12-20(6)34-23/h16-23,25-26,30-31,33H,11-15H2,1-10H3/b30-24-/t16-,17-,18+,19+,20+,21-,22+,23-,25+,26+,29+/m0/s1 |
| InChIKey | YFHNMNOEYZHSKM-LAZJMHHTSA-N |
| XLogP | 5.35 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|