C22H42INO5 — CID 145467930
(2R,3S,4R,5R,8R,10R,11R,12S,14R)-2-ethyl-3,4,10-trihydroxy-6-iodo-3,5,8,10,11,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 145467930) has the molecular formula C22H42INO5 and a molecular weight of 527.48 g/mol. Its IUPAC name is (2R,3S,4R,5R,8R,10R,11R,12S,14R)-2-ethyl-3,4,10-trihydroxy-6-iodo-3,5,8,10,11,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,3S,4R,5R,8R,10R,11R,12S,14R)-2-ethyl-3,4,10-trihydroxy-6-iodo-3,5,8,10,11,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 145467930 |
| Molecular Formula | C22H42INO5 |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | (2R,3S,4R,5R,8R,10R,11R,12S,14R)-2-ethyl-3,4,10-trihydroxy-6-iodo-3,5,8,10,11,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C[C@H](C)[C@@H](C)[C@](C)(O)C[C@@H](C)CN(I)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C22H42INO5/c1-9-18-22(8,28)19(25)17(6)24(23)12-13(2)11-21(7,27)16(5)14(3)10-15(4)20(26)29-18/h13-19,25,27-28H,9-12H2,1-8H3/t13-,14+,15-,16-,17-,18-,19-,21-,22-/m1/s1 |
| InChIKey | WMWWVSSMGMQGNH-JINUMBIHSA-N |
| XLogP | 3.55 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|