C26H49NO6 — CID 58756475
(2R,3S,4R,5R,8R,10R,11S,12R,14R)-11-tert-butyl-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione (PubChem CID 58756475) has the molecular formula C26H49NO6 and a molecular weight of 471.68 g/mol. Its IUPAC name is (2R,3S,4R,5R,8R,10R,11S,12R,14R)-11-tert-butyl-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione.
| Compound Name | (2R,3S,4R,5R,8R,10R,11S,12R,14R)-11-tert-butyl-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
|---|---|
| PubChem CID | 58756475 |
| Molecular Formula | C26H49NO6 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.36 |
| IUPAC Name | (2R,3S,4R,5R,8R,10R,11S,12R,14R)-11-tert-butyl-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](C(C)(C)C)[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C26H49NO6/c1-12-19-26(10,32)22(29)18(5)27(11)14-15(2)13-25(9,31)21(24(6,7)8)16(3)20(28)17(4)23(30)33-19/h15-19,21-22,29,31-32H,12-14H2,1-11H3/t15-,16+,17-,18-,19-,21+,22-,25-,26-/m1/s1 |
| InChIKey | TUUYZLANRRXMLN-LJNRZXJOSA-N |
| XLogP | 3.03 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|