C28H53N3O6 — CID 129313711
(1R,4R,5R,6S,7R,10R,12R,13R,14R)-16-[(3-aminopropylamino)methyl]-7,13-diethyl-5,6-dihydroxy-3,4,6,10,12,14-hexamethyl-8,15-dioxa-3-azabicyclo[12.2.1]heptadecane-9,11-dione (PubChem CID 129313711) has the molecular formula C28H53N3O6 and a molecular weight of 527.75 g/mol. Its IUPAC name is (1R,4R,5R,6S,7R,10R,12R,13R,14R)-16-[(3-aminopropylamino)methyl]-7,13-diethyl-5,6-dihydroxy-3,4,6,10,12,14-hexamethyl-8,15-dioxa-3-azabicyclo[12.2.1]heptadecane-9,11-dione.
| Compound Name | (1R,4R,5R,6S,7R,10R,12R,13R,14R)-16-[(3-aminopropylamino)methyl]-7,13-diethyl-5,6-dihydroxy-3,4,6,10,12,14-hexamethyl-8,15-dioxa-3-azabicyclo[12.2.1]heptadecane-9,11-dione |
|---|---|
| PubChem CID | 129313711 |
| Molecular Formula | C28H53N3O6 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.39 |
| IUPAC Name | (1R,4R,5R,6S,7R,10R,12R,13R,14R)-16-[(3-aminopropylamino)methyl]-7,13-diethyl-5,6-dihydroxy-3,4,6,10,12,14-hexamethyl-8,15-dioxa-3-azabicyclo[12.2.1]heptadecane-9,11-dione |
| SMILES | CC[C@@H]1[C@@H](C)C(=O)[C@@H](C)C(=O)O[C@H](CC)[C@@](C)(O)[C@H](O)[C@@H](C)N(C)C[C@H]2C[C@@]1(C)OC2CNCCCN |
| InChI | InChI=1S/C28H53N3O6/c1-9-21-17(3)24(32)18(4)26(34)36-23(10-2)28(7,35)25(33)19(5)31(8)16-20-14-27(21,6)37-22(20)15-30-13-11-12-29/h17-23,25,30,33,35H,9-16,29H2,1-8H3/t17-,18-,19-,20-,21-,22?,23-,25-,27-,28-/m1/s1 |
| InChIKey | TZTSVENRIIEDHY-QYQMJJJHSA-N |
| XLogP | 1.72 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|