C29H54N2O6 — CID 118135393
(1S,2R,5R,6S,7R,8R,11R,13S,17R)-5-ethyl-6,7-dihydroxy-2,6,8,9,11,13,17,18,18-nonamethylspiro[4,14,16-trioxa-9-azabicyclo[11.3.2]octadecane-15,4'-piperidine]-3-one (PubChem CID 118135393) has the molecular formula C29H54N2O6 and a molecular weight of 526.76 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R,8R,11R,13S,17R)-5-ethyl-6,7-dihydroxy-2,6,8,9,11,13,17,18,18-nonamethylspiro[4,14,16-trioxa-9-azabicyclo[11.3.2]octadecane-15,4'-piperidine]-3-one.
| Compound Name | (1S,2R,5R,6S,7R,8R,11R,13S,17R)-5-ethyl-6,7-dihydroxy-2,6,8,9,11,13,17,18,18-nonamethylspiro[4,14,16-trioxa-9-azabicyclo[11.3.2]octadecane-15,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 118135393 |
| Molecular Formula | C29H54N2O6 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.40 |
| IUPAC Name | (1S,2R,5R,6S,7R,8R,11R,13S,17R)-5-ethyl-6,7-dihydroxy-2,6,8,9,11,13,17,18,18-nonamethylspiro[4,14,16-trioxa-9-azabicyclo[11.3.2]octadecane-15,4'-piperidine]-3-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@H]2OC3(CCNCC3)O[C@@](C)(C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@]1(C)O)C(C)(C)[C@H]2C |
| InChI | InChI=1S/C29H54N2O6/c1-11-22-28(9,34)24(32)21(5)31(10)17-18(2)16-27(8)26(6,7)20(4)23(19(3)25(33)35-22)36-29(37-27)12-14-30-15-13-29/h18-24,30,32,34H,11-17H2,1-10H3/t18-,19-,20+,21-,22-,23-,24-,27+,28-/m1/s1 |
| InChIKey | DISBNRNERMULAC-KDTWERABSA-N |
| XLogP | 3.33 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |