C30H59N3O6 — CID 23547777
10-[2-[3-(dimethylamino)propylamino]ethoxy]-2-ethyl-3,4-dihydroxy-3,5,6,8,10,11,12,14-octamethyl-1-oxa-6-azacyclopentadecane-13,15-dione (PubChem CID 23547777) has the molecular formula C30H59N3O6 and a molecular weight of 557.82 g/mol. Its IUPAC name is 10-[2-[3-(dimethylamino)propylamino]ethoxy]-2-ethyl-3,4-dihydroxy-3,5,6,8,10,11,12,14-octamethyl-1-oxa-6-azacyclopentadecane-13,15-dione.
| Compound Name | 10-[2-[3-(dimethylamino)propylamino]ethoxy]-2-ethyl-3,4-dihydroxy-3,5,6,8,10,11,12,14-octamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
|---|---|
| PubChem CID | 23547777 |
| Molecular Formula | C30H59N3O6 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.44 |
| IUPAC Name | 10-[2-[3-(dimethylamino)propylamino]ethoxy]-2-ethyl-3,4-dihydroxy-3,5,6,8,10,11,12,14-octamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)C(C)C(C)(OCCNCCCN(C)C)CC(C)CN(C)C(C)C(O)C1(C)O |
| InChI | InChI=1S/C30H59N3O6/c1-12-25-30(8,37)27(35)24(6)33(11)19-20(2)18-29(7,38-17-15-31-14-13-16-32(9)10)23(5)21(3)26(34)22(4)28(36)39-25/h20-25,27,31,35,37H,12-19H2,1-11H3 |
| InChIKey | VBMNYUVSPWSITE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|