C26H46FNO6 — CID 143417561
(2R,3S,4R,5R,8S,10R,11R,12R,14S)-8-ethenyl-10-ethoxy-2-ethyl-14-fluoro-3,4-dihydroxy-3,5,6,10,11,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione (PubChem CID 143417561) has the molecular formula C26H46FNO6 and a molecular weight of 487.65 g/mol. Its IUPAC name is (2R,3S,4R,5R,8S,10R,11R,12R,14S)-8-ethenyl-10-ethoxy-2-ethyl-14-fluoro-3,4-dihydroxy-3,5,6,10,11,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione.
| Compound Name | (2R,3S,4R,5R,8S,10R,11R,12R,14S)-8-ethenyl-10-ethoxy-2-ethyl-14-fluoro-3,4-dihydroxy-3,5,6,10,11,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
|---|---|
| PubChem CID | 143417561 |
| Molecular Formula | C26H46FNO6 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | (2R,3S,4R,5R,8S,10R,11R,12R,14S)-8-ethenyl-10-ethoxy-2-ethyl-14-fluoro-3,4-dihydroxy-3,5,6,10,11,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
| SMILES | C=C[C@H]1CN(C)[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@](C)(F)C(=O)[C@H](C)[C@@H](C)[C@](C)(OCC)C1 |
| InChI | InChI=1S/C26H46FNO6/c1-11-19-14-24(7,33-13-3)17(5)16(4)21(29)25(8,27)23(31)34-20(12-2)26(9,32)22(30)18(6)28(10)15-19/h11,16-20,22,30,32H,1,12-15H2,2-10H3/t16-,17-,18-,19-,20-,22-,24-,25+,26-/m1/s1 |
| InChIKey | ULEZZIBFWDIOIA-OKBBJWEESA-N |
| XLogP | 3.31 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|