C27H50FNO6 — CID 71066629
(2R,3S,4R,5R,8R,10R,11R,12R,14S)-11-[(2S)-butan-2-yl]-2-ethyl-14-fluoro-3,4-dihydroxy-10-methoxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione (PubChem CID 71066629) has the molecular formula C27H50FNO6 and a molecular weight of 503.70 g/mol. Its IUPAC name is (2R,3S,4R,5R,8R,10R,11R,12R,14S)-11-[(2S)-butan-2-yl]-2-ethyl-14-fluoro-3,4-dihydroxy-10-methoxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione.
| Compound Name | (2R,3S,4R,5R,8R,10R,11R,12R,14S)-11-[(2S)-butan-2-yl]-2-ethyl-14-fluoro-3,4-dihydroxy-10-methoxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
|---|---|
| PubChem CID | 71066629 |
| Molecular Formula | C27H50FNO6 |
| Molecular Weight | 503.70 g/mol |
| Exact Mass | 503.36 |
| IUPAC Name | (2R,3S,4R,5R,8R,10R,11R,12R,14S)-11-[(2S)-butan-2-yl]-2-ethyl-14-fluoro-3,4-dihydroxy-10-methoxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
| SMILES | CC[C@H](C)[C@@H]1[C@@H](C)C(=O)[C@](C)(F)C(=O)O[C@H](CC)[C@@](C)(O)[C@H](O)[C@@H](C)N(C)C[C@H](C)C[C@@]1(C)OC |
| InChI | InChI=1S/C27H50FNO6/c1-12-17(4)21-18(5)22(30)26(8,28)24(32)35-20(13-2)27(9,33)23(31)19(6)29(10)15-16(3)14-25(21,7)34-11/h16-21,23,31,33H,12-15H2,1-11H3/t16-,17+,18-,19-,20-,21-,23-,25-,26+,27-/m1/s1 |
| InChIKey | RUAMYQBBVDCITC-OAOSMUQTSA-N |
| XLogP | 3.78 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|