C23H40INO6 — CID 145467501
(1S,3R,6R,7R,8S,9R,12R,14R)-9-ethyl-7,8-dihydroxy-5-iodo-1-methoxy-3,6,8,12,14,15-hexamethyl-10-oxa-5-azabicyclo[13.1.0]hexadecane-11,13-dione (PubChem CID 145467501) has the molecular formula C23H40INO6 and a molecular weight of 553.48 g/mol. Its IUPAC name is (1S,3R,6R,7R,8S,9R,12R,14R)-9-ethyl-7,8-dihydroxy-5-iodo-1-methoxy-3,6,8,12,14,15-hexamethyl-10-oxa-5-azabicyclo[13.1.0]hexadecane-11,13-dione.
| Compound Name | (1S,3R,6R,7R,8S,9R,12R,14R)-9-ethyl-7,8-dihydroxy-5-iodo-1-methoxy-3,6,8,12,14,15-hexamethyl-10-oxa-5-azabicyclo[13.1.0]hexadecane-11,13-dione |
|---|---|
| PubChem CID | 145467501 |
| Molecular Formula | C23H40INO6 |
| Molecular Weight | 553.48 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | (1S,3R,6R,7R,8S,9R,12R,14R)-9-ethyl-7,8-dihydroxy-5-iodo-1-methoxy-3,6,8,12,14,15-hexamethyl-10-oxa-5-azabicyclo[13.1.0]hexadecane-11,13-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)C2(C)C[C@@]2(OC)C[C@@H](C)CN(I)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C23H40INO6/c1-9-17-22(7,29)19(27)16(5)25(24)11-13(2)10-23(30-8)12-21(23,6)15(4)18(26)14(3)20(28)31-17/h13-17,19,27,29H,9-12H2,1-8H3/t13-,14-,15+,16-,17-,19-,21?,22-,23+/m1/s1 |
| InChIKey | ZOLPILMMEISRPU-TXIOKBTISA-N |
| XLogP | 3.14 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|