C21H41NO7 — CID 71256786
(2R,3S,4R,8R,10R,12S,13S,14R)-2-ethyl-3,4,10,11,13-pentahydroxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 71256786) has the molecular formula C21H41NO7 and a molecular weight of 419.56 g/mol. Its IUPAC name is (2R,3S,4R,8R,10R,12S,13S,14R)-2-ethyl-3,4,10,11,13-pentahydroxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,3S,4R,8R,10R,12S,13S,14R)-2-ethyl-3,4,10,11,13-pentahydroxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 71256786 |
| Molecular Formula | C21H41NO7 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | (2R,3S,4R,8R,10R,12S,13S,14R)-2-ethyl-3,4,10,11,13-pentahydroxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)C(O)[C@](C)(O)C[C@@H](C)CNC(C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C21H41NO7/c1-8-15-21(7,28)18(25)14(5)22-10-11(2)9-20(6,27)17(24)12(3)16(23)13(4)19(26)29-15/h11-18,22-25,27-28H,8-10H2,1-7H3/t11-,12+,13-,14?,15-,16+,17?,18-,20-,21-/m1/s1 |
| InChIKey | YVQORMRYJIKZSU-PEWNLOAHSA-N |
| XLogP | 0.18 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |