C20H39NO7 — CID 71267236
(2R,3S,4R,5R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10,11,13-pentahydroxy-3,5,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 71267236) has the molecular formula C20H39NO7 and a molecular weight of 405.53 g/mol. Its IUPAC name is (2R,3S,4R,5R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10,11,13-pentahydroxy-3,5,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,3S,4R,5R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10,11,13-pentahydroxy-3,5,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 71267236 |
| Molecular Formula | C20H39NO7 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (2R,3S,4R,5R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10,11,13-pentahydroxy-3,5,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@](C)(O)CCCN[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C20H39NO7/c1-7-14-20(6,27)17(24)13(4)21-10-8-9-19(5,26)16(23)11(2)15(22)12(3)18(25)28-14/h11-17,21-24,26-27H,7-10H2,1-6H3/t11-,12+,13+,14+,15-,16+,17+,19+,20+/m0/s1 |
| InChIKey | JTXXRKIXMZXXIK-PKLMKDLJSA-N |
| XLogP | -0.06 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |