C7H12O4 — CID 130875371
(3S,4S,5R)-5-ethyl-3,4-dihydroxy-4-methyloxolan-2-one (PubChem CID 130875371) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (3S,4S,5R)-5-ethyl-3,4-dihydroxy-4-methyloxolan-2-one.
| Compound Name | (3S,4S,5R)-5-ethyl-3,4-dihydroxy-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 130875371 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (3S,4S,5R)-5-ethyl-3,4-dihydroxy-4-methyloxolan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C7H12O4/c1-3-4-7(2,10)5(8)6(9)11-4/h4-5,8,10H,3H2,1-2H3/t4-,5-,7-/m1/s1 |
| InChIKey | AMJAASNCWNBMGQ-WYDQCIBASA-N |
| XLogP | -0.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |