C21H39NO5 — CID 143277701
(2R,3R,7R,9S,11S)-2-ethyl-3,4-dihydroxy-9-methoxy-3,7,9,11,13-pentamethyl-6-methylidene-1-oxa-5-azacyclotetradecan-14-one (PubChem CID 143277701) has the molecular formula C21H39NO5 and a molecular weight of 385.55 g/mol. Its IUPAC name is (2R,3R,7R,9S,11S)-2-ethyl-3,4-dihydroxy-9-methoxy-3,7,9,11,13-pentamethyl-6-methylidene-1-oxa-5-azacyclotetradecan-14-one.
| Compound Name | (2R,3R,7R,9S,11S)-2-ethyl-3,4-dihydroxy-9-methoxy-3,7,9,11,13-pentamethyl-6-methylidene-1-oxa-5-azacyclotetradecan-14-one |
|---|---|
| PubChem CID | 143277701 |
| Molecular Formula | C21H39NO5 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | (2R,3R,7R,9S,11S)-2-ethyl-3,4-dihydroxy-9-methoxy-3,7,9,11,13-pentamethyl-6-methylidene-1-oxa-5-azacyclotetradecan-14-one |
| SMILES | C=C1NC(O)[C@](C)(O)[C@@H](CC)OC(=O)C(C)C[C@H](C)C[C@](C)(OC)C[C@H]1C |
| InChI | InChI=1S/C21H39NO5/c1-9-17-21(7,25)19(24)22-16(5)15(4)12-20(6,26-8)11-13(2)10-14(3)18(23)27-17/h13-15,17,19,22,24-25H,5,9-12H2,1-4,6-8H3/t13-,14?,15+,17+,19?,20-,21+/m0/s1 |
| InChIKey | TVALBXKDTDUJFP-TVHXOYPPSA-N |
| XLogP | 2.98 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |