C22H35FO6 — CID 71193889
(3S,5R,7R,9R,11E,13S,14R)-14-ethyl-3-fluoro-13-hydroxy-7-methoxy-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione (PubChem CID 71193889) has the molecular formula C22H35FO6 and a molecular weight of 414.51 g/mol. Its IUPAC name is (3S,5R,7R,9R,11E,13S,14R)-14-ethyl-3-fluoro-13-hydroxy-7-methoxy-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione.
| Compound Name | (3S,5R,7R,9R,11E,13S,14R)-14-ethyl-3-fluoro-13-hydroxy-7-methoxy-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione |
|---|---|
| PubChem CID | 71193889 |
| Molecular Formula | C22H35FO6 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (3S,5R,7R,9R,11E,13S,14R)-14-ethyl-3-fluoro-13-hydroxy-7-methoxy-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione |
| SMILES | CC[C@H]1OC(=O)[C@@](C)(F)C(=O)[C@H](C)C[C@](C)(OC)C[C@@H](C)C(=O)/C(C)=C/[C@]1(C)O |
| InChI | InChI=1S/C22H35FO6/c1-9-16-21(6,27)12-14(3)17(24)13(2)10-20(5,28-8)11-15(4)18(25)22(7,23)19(26)29-16/h12-13,15-16,27H,9-11H2,1-8H3/b14-12+/t13-,15-,16-,20-,21+,22+/m1/s1 |
| InChIKey | XIWFIZDLQUJPBP-SCILBYMUSA-N |
| XLogP | 3.34 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|