C34H50O7S — CID 143853526
[(2R,3S,4E,7R,9S,11R,13R)-12-ethenyl-2-ethyl-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradec-4-en-3-yl] 2-[(4-methoxyphenyl)methylsulfanyl]acetate (PubChem CID 143853526) has the molecular formula C34H50O7S and a molecular weight of 602.83 g/mol. Its IUPAC name is [(2R,3S,4E,7R,9S,11R,13R)-12-ethenyl-2-ethyl-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradec-4-en-3-yl] 2-[(4-methoxyphenyl)methylsulfanyl]acetate.
| Compound Name | [(2R,3S,4E,7R,9S,11R,13R)-12-ethenyl-2-ethyl-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradec-4-en-3-yl] 2-[(4-methoxyphenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 143853526 |
| Molecular Formula | C34H50O7S |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | [(2R,3S,4E,7R,9S,11R,13R)-12-ethenyl-2-ethyl-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradec-4-en-3-yl] 2-[(4-methoxyphenyl)methylsulfanyl]acetate |
| SMILES | C=CC1[C@H](C)C[C@](C)(OC)C[C@@H](C)C(=O)/C(C)=C/[C@](C)(OC(=O)CSCc2ccc(OC)cc2)[C@@H](CC)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C34H50O7S/c1-11-28-22(3)17-33(7,39-10)18-23(4)31(36)24(5)19-34(8,29(12-2)40-32(37)25(28)6)41-30(35)21-42-20-26-13-15-27(38-9)16-14-26/h11,13-16,19,22-23,25,28-29H,1,12,17-18,20-21H2,2-10H3/b24-19+/t22-,23-,25-,28?,29-,33+,34+/m1/s1 |
| InChIKey | YZPUBRMUOFBOEO-BVIMFYRCSA-N |
| XLogP | 6.98 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|