C25H39NO7 — CID 91382414
(1S,2S,5R,7R,9S,11R,13S,16R)-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,18-dioxa-15-azatricyclo[11.5.1.016,19]nonadecane-4,6,12,17-tetrone (PubChem CID 91382414) has the molecular formula C25H39NO7 and a molecular weight of 465.59 g/mol. Its IUPAC name is (1S,2S,5R,7R,9S,11R,13S,16R)-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,18-dioxa-15-azatricyclo[11.5.1.016,19]nonadecane-4,6,12,17-tetrone.
| Compound Name | (1S,2S,5R,7R,9S,11R,13S,16R)-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,18-dioxa-15-azatricyclo[11.5.1.016,19]nonadecane-4,6,12,17-tetrone |
|---|---|
| PubChem CID | 91382414 |
| Molecular Formula | C25H39NO7 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (1S,2S,5R,7R,9S,11R,13S,16R)-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,18-dioxa-15-azatricyclo[11.5.1.016,19]nonadecane-4,6,12,17-tetrone |
| SMILES | CC[C@@H]1OC(=O)[C@H](C)C(=O)[C@H](C)C[C@](C)(OC)C[C@@H](C)C(=O)[C@]2(C)CNC3C(=O)O[C@@]1(C)C32 |
| InChI | InChI=1S/C25H39NO7/c1-9-16-25(7)19-17(22(30)33-25)26-12-24(19,6)20(28)14(3)11-23(5,31-8)10-13(2)18(27)15(4)21(29)32-16/h13-17,19,26H,9-12H2,1-8H3/t13-,14-,15-,16+,17?,19?,23+,24-,25-/m1/s1 |
| InChIKey | CYPFCNJDMRQXBF-LQMMODPJSA-N |
| XLogP | 2.46 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|