C31H47NO7S — CID 142660633
2-ethyl-6-hydroxy-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(2-pyridin-2-ylethylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,12,16-trione (PubChem CID 142660633) has the molecular formula C31H47NO7S and a molecular weight of 577.78 g/mol. Its IUPAC name is 2-ethyl-6-hydroxy-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(2-pyridin-2-ylethylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,12,16-trione.
| Compound Name | 2-ethyl-6-hydroxy-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(2-pyridin-2-ylethylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,12,16-trione |
|---|---|
| PubChem CID | 142660633 |
| Molecular Formula | C31H47NO7S |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 2-ethyl-6-hydroxy-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(2-pyridin-2-ylethylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,12,16-trione |
| SMILES | CCC1OC(=O)C(C)C(O)C(C)CC(C)(OC)CC(C)C(=O)C(C)C2C(SCCc3ccccn3)C(=O)OC12C |
| InChI | InChI=1S/C31H47NO7S/c1-9-23-31(7)24(27(29(36)39-31)40-15-13-22-12-10-11-14-32-22)20(4)25(33)18(2)16-30(6,37-8)17-19(3)26(34)21(5)28(35)38-23/h10-12,14,18-21,23-24,26-27,34H,9,13,15-17H2,1-8H3 |
| InChIKey | RSPSGJRANBBQSC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |