C33H49N3O7S — CID 142660647
2-ethyl-6-hydroxy-15-(3-imidazo[4,5-b]pyridin-3-ylpropylsulfanyl)-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,12,16-trione (PubChem CID 142660647) has the molecular formula C33H49N3O7S and a molecular weight of 631.84 g/mol. Its IUPAC name is 2-ethyl-6-hydroxy-15-(3-imidazo[4,5-b]pyridin-3-ylpropylsulfanyl)-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,12,16-trione.
| Compound Name | 2-ethyl-6-hydroxy-15-(3-imidazo[4,5-b]pyridin-3-ylpropylsulfanyl)-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,12,16-trione |
|---|---|
| PubChem CID | 142660647 |
| Molecular Formula | C33H49N3O7S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | 2-ethyl-6-hydroxy-15-(3-imidazo[4,5-b]pyridin-3-ylpropylsulfanyl)-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,12,16-trione |
| SMILES | CCC1OC(=O)C(C)C(O)C(C)CC(C)(OC)CC(C)C(=O)C(C)C2C(SCCCn3cnc4cccnc43)C(=O)OC12C |
| InChI | InChI=1S/C33H49N3O7S/c1-9-24-33(7)25(28(31(40)43-33)44-15-11-14-36-18-35-23-12-10-13-34-29(23)36)21(4)26(37)19(2)16-32(6,41-8)17-20(3)27(38)22(5)30(39)42-24/h10,12-13,18-22,24-25,27-28,38H,9,11,14-17H2,1-8H3 |
| InChIKey | OTLIJWCQXZFAEZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|