C32H47NO7S — CID 142660654
2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(3-pyridin-2-ylpropylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 142660654) has the molecular formula C32H47NO7S and a molecular weight of 589.80 g/mol. Its IUPAC name is 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(3-pyridin-2-ylpropylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(3-pyridin-2-ylpropylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 142660654 |
| Molecular Formula | C32H47NO7S |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(3-pyridin-2-ylpropylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)CC(C)(OC)CC(C)C(=O)C(C)C2C(SCCCc3ccccn3)C(=O)OC12C |
| InChI | InChI=1S/C32H47NO7S/c1-9-24-32(7)25(28(30(37)40-32)41-16-12-14-23-13-10-11-15-33-23)21(4)26(34)19(2)17-31(6,38-8)18-20(3)27(35)22(5)29(36)39-24/h10-11,13,15,19-22,24-25,28H,9,12,14,16-18H2,1-8H3 |
| InChIKey | BJXAVLKSVNFLLY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|