C31H44N4O7S — CID 142660632
2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(2-purin-9-ylethylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 142660632) has the molecular formula C31H44N4O7S and a molecular weight of 616.78 g/mol. Its IUPAC name is 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(2-purin-9-ylethylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(2-purin-9-ylethylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 142660632 |
| Molecular Formula | C31H44N4O7S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-(2-purin-9-ylethylsulfanyl)-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)CC(C)(OC)CC(C)C(=O)C(C)C2C(SCCn3cnc4cncnc43)C(=O)OC12C |
| InChI | InChI=1S/C31H44N4O7S/c1-9-22-31(7)23(26(29(39)42-31)43-11-10-35-16-34-21-14-32-15-33-27(21)35)19(4)24(36)17(2)12-30(6,40-8)13-18(3)25(37)20(5)28(38)41-22/h14-20,22-23,26H,9-13H2,1-8H3 |
| InChIKey | SGXUTHUIKGYFAW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 139.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|