C27H45NO7 — CID 23547994
8-tert-butyl-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 23547994) has the molecular formula C27H45NO7 and a molecular weight of 495.66 g/mol. Its IUPAC name is 8-tert-butyl-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | 8-tert-butyl-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 23547994 |
| Molecular Formula | C27H45NO7 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | 8-tert-butyl-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)C(C(C)(C)C)C(C)(OC)CC(C)C(=O)C(C)C2NC(=O)OC12C |
| InChI | InChI=1S/C27H45NO7/c1-12-18-27(10)22(28-24(32)35-27)16(4)19(29)14(2)13-26(9,33-11)21(25(6,7)8)15(3)20(30)17(5)23(31)34-18/h14-18,21-22H,12-13H2,1-11H3,(H,28,32) |
| InChIKey | RLBVGVFKKBEMTI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|