C26H49NO6 — CID 170255839
[(2R,3R,4R,5R,8R,10S,12S,14R)-2-ethyl-3,10-dihydroxy-3,5,6,8,10,12,14-heptamethyl-15-oxo-1-oxa-6-azacyclopentadec-4-yl] butanoate (PubChem CID 170255839) has the molecular formula C26H49NO6 and a molecular weight of 471.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R,8R,10S,12S,14R)-2-ethyl-3,10-dihydroxy-3,5,6,8,10,12,14-heptamethyl-15-oxo-1-oxa-6-azacyclopentadec-4-yl] butanoate.
| Compound Name | [(2R,3R,4R,5R,8R,10S,12S,14R)-2-ethyl-3,10-dihydroxy-3,5,6,8,10,12,14-heptamethyl-15-oxo-1-oxa-6-azacyclopentadec-4-yl] butanoate |
|---|---|
| PubChem CID | 170255839 |
| Molecular Formula | C26H49NO6 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.36 |
| IUPAC Name | [(2R,3R,4R,5R,8R,10S,12S,14R)-2-ethyl-3,10-dihydroxy-3,5,6,8,10,12,14-heptamethyl-15-oxo-1-oxa-6-azacyclopentadec-4-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1[C@@H](C)N(C)C[C@H](C)C[C@@](C)(O)C[C@@H](C)C[C@@H](C)C(=O)O[C@H](CC)[C@@]1(C)O |
| InChI | InChI=1S/C26H49NO6/c1-10-12-22(28)33-23-20(6)27(9)16-18(4)15-25(7,30)14-17(3)13-19(5)24(29)32-21(11-2)26(23,8)31/h17-21,23,30-31H,10-16H2,1-9H3/t17-,18+,19+,20+,21+,23+,25-,26+/m0/s1 |
| InChIKey | JPGUIRUFKPEZKN-JPDVAPNLSA-N |
| XLogP | 3.93 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |