C20H39NO5 — CID 71207084
(2S,4R,8S,10S)-3,4,10-trihydroxy-2,3,5,6,8,10,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 71207084) has the molecular formula C20H39NO5 and a molecular weight of 373.53 g/mol. Its IUPAC name is (2S,4R,8S,10S)-3,4,10-trihydroxy-2,3,5,6,8,10,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2S,4R,8S,10S)-3,4,10-trihydroxy-2,3,5,6,8,10,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 71207084 |
| Molecular Formula | C20H39NO5 |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | (2S,4R,8S,10S)-3,4,10-trihydroxy-2,3,5,6,8,10,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC1CCC[C@](C)(O)C[C@H](C)CN(C)C(C)[C@@H](O)C(C)(O)[C@H](C)OC1=O |
| InChI | InChI=1S/C20H39NO5/c1-13-11-19(5,24)10-8-9-14(2)18(23)26-16(4)20(6,25)17(22)15(3)21(7)12-13/h13-17,22,24-25H,8-12H2,1-7H3/t13-,14?,15?,16-,17+,19-,20?/m0/s1 |
| InChIKey | KLFXDCCQFYEBPS-RVEIIUFQSA-N |
| XLogP | 1.95 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |