C23H45NO5 — CID 142879241
(2R,3R,5S,8R,9S,10R,12R,14R)-5-ethyl-3,4,9,12-tetrahydroxy-1,2,4,8,10,12,14-heptamethyl-azacyclopentadecan-7-one (PubChem CID 142879241) has the molecular formula C23H45NO5 and a molecular weight of 415.62 g/mol. Its IUPAC name is (2R,3R,5S,8R,9S,10R,12R,14R)-5-ethyl-3,4,9,12-tetrahydroxy-1,2,4,8,10,12,14-heptamethyl-azacyclopentadecan-7-one.
| Compound Name | (2R,3R,5S,8R,9S,10R,12R,14R)-5-ethyl-3,4,9,12-tetrahydroxy-1,2,4,8,10,12,14-heptamethyl-azacyclopentadecan-7-one |
|---|---|
| PubChem CID | 142879241 |
| Molecular Formula | C23H45NO5 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | (2R,3R,5S,8R,9S,10R,12R,14R)-5-ethyl-3,4,9,12-tetrahydroxy-1,2,4,8,10,12,14-heptamethyl-azacyclopentadecan-7-one |
| SMILES | CC[C@H]1CC(=O)[C@H](C)[C@@H](O)[C@H](C)C[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)C1(C)O |
| InChI | InChI=1S/C23H45NO5/c1-9-18-10-19(25)16(4)20(26)15(3)12-22(6,28)11-14(2)13-24(8)17(5)21(27)23(18,7)29/h14-18,20-21,26-29H,9-13H2,1-8H3/t14-,15-,16+,17-,18+,20+,21-,22-,23?/m1/s1 |
| InChIKey | ZBIMXVSFTORFRM-CZXAVUAXSA-N |
| XLogP | 2.22 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |