C20H39NO6 — CID 143226711
(2R,4R,8R,11R,12S)-2-ethyl-3,4,10,11-tetrahydroxy-6,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 143226711) has the molecular formula C20H39NO6 and a molecular weight of 389.53 g/mol. Its IUPAC name is (2R,4R,8R,11R,12S)-2-ethyl-3,4,10,11-tetrahydroxy-6,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,4R,8R,11R,12S)-2-ethyl-3,4,10,11-tetrahydroxy-6,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 143226711 |
| Molecular Formula | C20H39NO6 |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | (2R,4R,8R,11R,12S)-2-ethyl-3,4,10,11-tetrahydroxy-6,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)C(C)C[C@H](C)[C@@H](O)C(C)(O)C[C@@H](C)CN(C)C[C@@H](O)C1O |
| InChI | InChI=1S/C20H39NO6/c1-7-16-17(23)15(22)11-21(6)10-12(2)9-20(5,26)18(24)13(3)8-14(4)19(25)27-16/h12-18,22-24,26H,7-11H2,1-6H3/t12-,13+,14?,15-,16-,17?,18-,20?/m1/s1 |
| InChIKey | GLRFVDUYJKVTCH-VQEOLLRNSA-N |
| XLogP | 0.78 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |