C8H13ClO2 — CID 142897211
(3R,5R,6S)-6-(chloromethyl)-3,5-dimethyloxan-2-one (PubChem CID 142897211) has the molecular formula C8H13ClO2 and a molecular weight of 176.64 g/mol. Its IUPAC name is (3R,5R,6S)-6-(chloromethyl)-3,5-dimethyloxan-2-one.
| Compound Name | (3R,5R,6S)-6-(chloromethyl)-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 142897211 |
| Molecular Formula | C8H13ClO2 |
| Molecular Weight | 176.64 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (3R,5R,6S)-6-(chloromethyl)-3,5-dimethyloxan-2-one |
| SMILES | C[C@@H]1C[C@@H](C)[C@@H](CCl)OC1=O |
| InChI | InChI=1S/C8H13ClO2/c1-5-3-6(2)8(10)11-7(5)4-9/h5-7H,3-4H2,1-2H3/t5-,6-,7-/m1/s1 |
| InChIKey | BTHYQQFTEHKMEV-FSDSQADBSA-N |
| XLogP | 1.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|