C22H41NO6 — CID 89224780
(3R,4S,5R,7R,9R,11S,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-10-imino-4-methoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one (PubChem CID 89224780) has the molecular formula C22H41NO6 and a molecular weight of 415.57 g/mol. Its IUPAC name is (3R,4S,5R,7R,9R,11S,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-10-imino-4-methoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one.
| Compound Name | (3R,4S,5R,7R,9R,11S,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-10-imino-4-methoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 89224780 |
| Molecular Formula | C22H41NO6 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | (3R,4S,5R,7R,9R,11S,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-10-imino-4-methoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
| SMILES | [H]/N=C1/[C@H](C)C[C@@](C)(O)C[C@@H](C)[C@H](OC)[C@@H](C)C(=O)O[C@H](CC)[C@@](C)(O)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C22H41NO6/c1-9-16-22(7,27)19(24)14(4)17(23)12(2)10-21(6,26)11-13(3)18(28-8)15(5)20(25)29-16/h12-16,18-19,23-24,26-27H,9-11H2,1-8H3/b23-17-/t12-,13-,14+,15-,16-,18+,19-,21-,22-/m1/s1 |
| InChIKey | BALYZUXGXKLEKY-DPGREDHGSA-N |
| XLogP | 2.54 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|