C26H51NO7 — CID 59957671
(2R,3S,4R,5S,8R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10-trihydroxy-11,13-dimethoxy-3,5,8,10,12,14-hexamethyl-7-propyl-1-oxa-7-azacyclopentadecan-15-one (PubChem CID 59957671) has the molecular formula C26H51NO7 and a molecular weight of 489.69 g/mol. Its IUPAC name is (2R,3S,4R,5S,8R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10-trihydroxy-11,13-dimethoxy-3,5,8,10,12,14-hexamethyl-7-propyl-1-oxa-7-azacyclopentadecan-15-one.
| Compound Name | (2R,3S,4R,5S,8R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10-trihydroxy-11,13-dimethoxy-3,5,8,10,12,14-hexamethyl-7-propyl-1-oxa-7-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 59957671 |
| Molecular Formula | C26H51NO7 |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.37 |
| IUPAC Name | (2R,3S,4R,5S,8R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10-trihydroxy-11,13-dimethoxy-3,5,8,10,12,14-hexamethyl-7-propyl-1-oxa-7-azacyclopentadecan-15-one |
| SMILES | CCCN1C[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@H](C)[C@@H](OC)[C@H](C)[C@@H](OC)[C@](C)(O)C[C@H]1C |
| InChI | InChI=1S/C26H51NO7/c1-11-13-27-15-16(3)22(28)26(8,31)20(12-2)34-24(29)19(6)21(32-9)18(5)23(33-10)25(7,30)14-17(27)4/h16-23,28,30-31H,11-15H2,1-10H3/t16-,17+,18-,19+,20+,21-,22+,23+,25+,26+/m0/s1 |
| InChIKey | KBRBRLWEAZJBBW-STASKZMDSA-N |
| XLogP | 2.61 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |