C7H7F3O5 — CID 140973456
6-ethyl-5-hydroxy-5-(trifluoromethyl)-1,4-dioxane-2,3-dione (PubChem CID 140973456) has the molecular formula C7H7F3O5 and a molecular weight of 228.12 g/mol. Its IUPAC name is 6-ethyl-5-hydroxy-5-(trifluoromethyl)-1,4-dioxane-2,3-dione.
| Compound Name | 6-ethyl-5-hydroxy-5-(trifluoromethyl)-1,4-dioxane-2,3-dione |
|---|---|
| PubChem CID | 140973456 |
| Molecular Formula | C7H7F3O5 |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 6-ethyl-5-hydroxy-5-(trifluoromethyl)-1,4-dioxane-2,3-dione |
| SMILES | CCC1OC(=O)C(=O)OC1(O)C(F)(F)F |
| InChI | InChI=1S/C7H7F3O5/c1-2-3-6(13,7(8,9)10)15-5(12)4(11)14-3/h3,13H,2H2,1H3 |
| InChIKey | NMFQRRRBPQECFW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|