C6H4F6O2 — CID 102249108
3-methyl-4,4-bis(trifluoromethyl)oxetan-2-one (PubChem CID 102249108) has the molecular formula C6H4F6O2 and a molecular weight of 222.08 g/mol. Its IUPAC name is 3-methyl-4,4-bis(trifluoromethyl)oxetan-2-one.
| Compound Name | 3-methyl-4,4-bis(trifluoromethyl)oxetan-2-one |
|---|---|
| PubChem CID | 102249108 |
| Molecular Formula | C6H4F6O2 |
| Molecular Weight | 222.08 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 3-methyl-4,4-bis(trifluoromethyl)oxetan-2-one |
| SMILES | CC1C(=O)OC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F6O2/c1-2-3(13)14-4(2,5(7,8)9)6(10,11)12/h2H,1H3 |
| InChIKey | VGZVNVWURHTVRX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.08 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|