C6H7F3O2 — CID 7159230
(3S,5S)-5-methyl-3-(trifluoromethyl)oxolan-2-one (PubChem CID 7159230) has the molecular formula C6H7F3O2 and a molecular weight of 168.11 g/mol. Its IUPAC name is (3S,5S)-5-methyl-3-(trifluoromethyl)oxolan-2-one.
| Compound Name | (3S,5S)-5-methyl-3-(trifluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 7159230 |
| Molecular Formula | C6H7F3O2 |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (3S,5S)-5-methyl-3-(trifluoromethyl)oxolan-2-one |
| SMILES | C[C@H]1C[C@H](C(F)(F)F)C(=O)O1 |
| InChI | InChI=1S/C6H7F3O2/c1-3-2-4(5(10)11-3)6(7,8)9/h3-4H,2H2,1H3/t3-,4-/m0/s1 |
| InChIKey | QYTOOVCITOVYEL-IMJSIDKUSA-N |
| XLogP | 1.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |