C6H8O4 — CID 129375031
(3R,5R)-5-methyl-2-oxooxolane-3-carboxylic acid (PubChem CID 129375031) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is (3R,5R)-5-methyl-2-oxooxolane-3-carboxylic acid.
| Compound Name | (3R,5R)-5-methyl-2-oxooxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 129375031 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (3R,5R)-5-methyl-2-oxooxolane-3-carboxylic acid |
| SMILES | C[C@@H]1C[C@H](C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C6H8O4/c1-3-2-4(5(7)8)6(9)10-3/h3-4H,2H2,1H3,(H,7,8)/t3-,4-/m1/s1 |
| InChIKey | IDQXNIBOTPWGCF-QWWZWVQMSA-N |
| XLogP | 0.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|