About 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione
5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione (PubChem CID 154679095) has the molecular formula C6H6O6
and a molecular weight of 174.11 g/mol. Its IUPAC name is 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione.
Analyze 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione?
The IUPAC name of 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione (CID 154679095) is 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione.
What is the SMILES notation for 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione?
The canonical SMILES for 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione is CCC1OC(=O)OC12OC(=O)O2.
What is the InChIKey of 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione?
The InChIKey is RMLFJJRXYMFIQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O6/c1-2-3-6(10-4(7)9-3)11-5(8)12-6/h3H,2H2,1H3.
What are the key properties of 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione?
5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione has a molecular weight of 174.11 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3,6,8-tetraoxaspiro[3.4]octane-2,7-dione is sourced from PubChem (CID 154679095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).