C26H46FNO6 — CID 143417780
(3R,6R,7R,9R,11S,12R,13S,14R)-14-ethyl-10-(4-fluorobutylimino)-12,13-dihydroxy-7-methoxy-3,6,7,9,11,13-hexamethyl-oxacyclotetradecane-2,4-dione (PubChem CID 143417780) has the molecular formula C26H46FNO6 and a molecular weight of 487.65 g/mol. Its IUPAC name is (3R,6R,7R,9R,11S,12R,13S,14R)-14-ethyl-10-(4-fluorobutylimino)-12,13-dihydroxy-7-methoxy-3,6,7,9,11,13-hexamethyl-oxacyclotetradecane-2,4-dione.
| Compound Name | (3R,6R,7R,9R,11S,12R,13S,14R)-14-ethyl-10-(4-fluorobutylimino)-12,13-dihydroxy-7-methoxy-3,6,7,9,11,13-hexamethyl-oxacyclotetradecane-2,4-dione |
|---|---|
| PubChem CID | 143417780 |
| Molecular Formula | C26H46FNO6 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | (3R,6R,7R,9R,11S,12R,13S,14R)-14-ethyl-10-(4-fluorobutylimino)-12,13-dihydroxy-7-methoxy-3,6,7,9,11,13-hexamethyl-oxacyclotetradecane-2,4-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)C[C@@H](C)[C@](C)(OC)C[C@@H](C)/C(=N/CCCCF)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C26H46FNO6/c1-9-21-26(7,32)23(30)19(5)22(28-13-11-10-12-27)16(2)15-25(6,33-8)17(3)14-20(29)18(4)24(31)34-21/h16-19,21,23,30,32H,9-15H2,1-8H3/b28-22-/t16-,17-,18-,19+,21-,23-,25-,26-/m1/s1 |
| InChIKey | LBLWSIRBUAJUAR-YEGBAUPBSA-N |
| XLogP | 3.92 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|