C22H35IO5 — CID 89372236
(3R,6R,7R,9Z,11E,14R)-14-ethyl-6-iodo-7,13-dimethoxy-3,7,9,11,13-pentamethyl-1-oxacyclotetradeca-9,11-diene-2,4-dione (PubChem CID 89372236) has the molecular formula C22H35IO5 and a molecular weight of 506.42 g/mol. Its IUPAC name is (3R,6R,7R,9Z,11E,14R)-14-ethyl-6-iodo-7,13-dimethoxy-3,7,9,11,13-pentamethyl-1-oxacyclotetradeca-9,11-diene-2,4-dione.
| Compound Name | (3R,6R,7R,9Z,11E,14R)-14-ethyl-6-iodo-7,13-dimethoxy-3,7,9,11,13-pentamethyl-1-oxacyclotetradeca-9,11-diene-2,4-dione |
|---|---|
| PubChem CID | 89372236 |
| Molecular Formula | C22H35IO5 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (3R,6R,7R,9Z,11E,14R)-14-ethyl-6-iodo-7,13-dimethoxy-3,7,9,11,13-pentamethyl-1-oxacyclotetradeca-9,11-diene-2,4-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)C[C@@H](I)[C@](C)(OC)C/C(C)=C\C(C)=C\C1(C)OC |
| InChI | InChI=1S/C22H35IO5/c1-9-19-22(6,27-8)13-15(3)10-14(2)12-21(5,26-7)18(23)11-17(24)16(4)20(25)28-19/h10,13,16,18-19H,9,11-12H2,1-8H3/b14-10-,15-13+/t16-,18-,19-,21-,22?/m1/s1 |
| InChIKey | OMUOXCIXQIGHMB-QYCYESRGSA-N |
| XLogP | 4.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|