C19H16O2S — CID 177387594
[(2R,3S,4S)-4-hydroxy-2-(2-phenylethynyl)thiolan-3-yl]-phenylmethanone (PubChem CID 177387594) has the molecular formula C19H16O2S and a molecular weight of 308.40 g/mol. Its IUPAC name is [(2R,3S,4S)-4-hydroxy-2-(2-phenylethynyl)thiolan-3-yl]-phenylmethanone.
| Compound Name | [(2R,3S,4S)-4-hydroxy-2-(2-phenylethynyl)thiolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 177387594 |
| Molecular Formula | C19H16O2S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [(2R,3S,4S)-4-hydroxy-2-(2-phenylethynyl)thiolan-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H](O)CS[C@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C19H16O2S/c20-16-13-22-17(12-11-14-7-3-1-4-8-14)18(16)19(21)15-9-5-2-6-10-15/h1-10,16-18,20H,13H2/t16-,17+,18-/m1/s1 |
| InChIKey | MNVFSKYYAKKYSP-FGTMMUONSA-N |
| XLogP | 3.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|