C26H42N4O7 — CID 90378432
(1S,8S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-8-hydroxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 90378432) has the molecular formula C26H42N4O7 and a molecular weight of 522.64 g/mol. Its IUPAC name is (1S,8S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-8-hydroxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,8S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-8-hydroxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 90378432 |
| Molecular Formula | C26H42N4O7 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | (1S,8S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-8-hydroxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)[C@@H](O)C(C)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(CCCCN=[N+]=[N-])C(=O)O[C@]12C |
| InChI | InChI=1S/C26H42N4O7/c1-8-19-26(7)23(30(25(35)37-26)12-10-9-11-28-29-27)17(5)21(32)15(3)13-14(2)20(31)16(4)22(33)18(6)24(34)36-19/h14-20,23,31H,8-13H2,1-7H3/t14?,15-,16?,17+,18?,19?,20+,23-,26-/m1/s1 |
| InChIKey | TZLXKBDNIMQMAF-PLFCMTLISA-N |
| XLogP | 4.06 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|