C27H42N4O7 — CID 70961752
(2S,9R,10S,12R,15R)-16-(4-azidobutyl)-10-methoxy-2,6,8,9,10,12,14-heptamethyl-4,18-dioxa-16-azatricyclo[13.3.0.01,3]octadecane-5,7,13,17-tetrone (PubChem CID 70961752) has the molecular formula C27H42N4O7 and a molecular weight of 534.65 g/mol. Its IUPAC name is (2S,9R,10S,12R,15R)-16-(4-azidobutyl)-10-methoxy-2,6,8,9,10,12,14-heptamethyl-4,18-dioxa-16-azatricyclo[13.3.0.01,3]octadecane-5,7,13,17-tetrone.
| Compound Name | (2S,9R,10S,12R,15R)-16-(4-azidobutyl)-10-methoxy-2,6,8,9,10,12,14-heptamethyl-4,18-dioxa-16-azatricyclo[13.3.0.01,3]octadecane-5,7,13,17-tetrone |
|---|---|
| PubChem CID | 70961752 |
| Molecular Formula | C27H42N4O7 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | (2S,9R,10S,12R,15R)-16-(4-azidobutyl)-10-methoxy-2,6,8,9,10,12,14-heptamethyl-4,18-dioxa-16-azatricyclo[13.3.0.01,3]octadecane-5,7,13,17-tetrone |
| SMILES | CO[C@@]1(C)C[C@@H](C)C(=O)C(C)[C@H]2N(CCCCN=[N+]=[N-])C(=O)OC23C(C)C3OC(=O)C(C)C(=O)C(C)[C@H]1C |
| InChI | InChI=1S/C27H42N4O7/c1-14-13-26(7,36-8)18(5)15(2)21(33)17(4)24(34)37-23-19(6)27(23)22(16(3)20(14)32)31(25(35)38-27)12-10-9-11-29-30-28/h14-19,22-23H,9-13H2,1-8H3/t14-,15?,16?,17?,18-,19?,22-,23?,26+,27?/m1/s1 |
| InChIKey | MLROMHLXUSBQCR-NJADZNSXSA-N |
| XLogP | 4.33 |
| TPSA | 147.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|