C27H43FN4O8 — CID 90378427
(1S,8R,9S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-5-fluoro-8-hydroxy-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 90378427) has the molecular formula C27H43FN4O8 and a molecular weight of 570.66 g/mol. Its IUPAC name is (1S,8R,9S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-5-fluoro-8-hydroxy-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,8R,9S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-5-fluoro-8-hydroxy-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 90378427 |
| Molecular Formula | C27H43FN4O8 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | (1S,8R,9S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-5-fluoro-8-hydroxy-9-methoxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CCC1OC(=O)C(C)(F)C(=O)C(C)[C@@H](O)[C@@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(CCCCN=[N+]=[N-])C(=O)O[C@]12C |
| InChI | InChI=1S/C27H43FN4O8/c1-9-18-27(7)20(32(24(37)40-27)13-11-10-12-30-31-29)16(3)19(33)15(2)14-25(5,38-8)21(34)17(4)22(35)26(6,28)23(36)39-18/h15-18,20-21,34H,9-14H2,1-8H3/t15-,16+,17?,18?,20-,21-,25+,26?,27-/m1/s1 |
| InChIKey | HFBPGBDKGYCCMR-RRHNFKQWSA-N |
| XLogP | 3.92 |
| TPSA | 168.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|