C36H50F3N5O7 — CID 123629858
N-[3-[1-[4-(2-ethyl-6-hydroxy-1,5,7,9,11,13-hexamethyl-4,12,16-trioxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-15-yl)butyl]triazol-4-yl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 123629858) has the molecular formula C36H50F3N5O7 and a molecular weight of 721.82 g/mol. Its IUPAC name is N-[3-[1-[4-(2-ethyl-6-hydroxy-1,5,7,9,11,13-hexamethyl-4,12,16-trioxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-15-yl)butyl]triazol-4-yl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-[4-(2-ethyl-6-hydroxy-1,5,7,9,11,13-hexamethyl-4,12,16-trioxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-15-yl)butyl]triazol-4-yl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 123629858 |
| Molecular Formula | C36H50F3N5O7 |
| Molecular Weight | 721.82 g/mol |
| Exact Mass | 721.37 |
| IUPAC Name | N-[3-[1-[4-(2-ethyl-6-hydroxy-1,5,7,9,11,13-hexamethyl-4,12,16-trioxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-15-yl)butyl]triazol-4-yl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CCC1OC(=O)C(C)C(O)C(C)CC(C)CC(C)C(=O)C(C)C2N(CCCCn3cc(-c4cccc(NC(=O)C(F)(F)F)c4)nn3)C(=O)OC12C |
| InChI | InChI=1S/C36H50F3N5O7/c1-8-28-35(7)31(23(5)29(45)21(3)16-20(2)17-22(4)30(46)24(6)32(47)50-28)44(34(49)51-35)15-10-9-14-43-19-27(41-42-43)25-12-11-13-26(18-25)40-33(48)36(37,38)39/h11-13,18-24,28,30-31,46H,8-10,14-17H2,1-7H3,(H,40,48) |
| InChIKey | LPEHYIVVOKLKHB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.82 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|