C35H53BN6O6 — CID 140848049
CID 140848049 (PubChem CID 140848049) has the molecular formula C35H53BN6O6 and a molecular weight of 664.66 g/mol.
| Compound Name | CID 140848049 |
|---|---|
| PubChem CID | 140848049 |
| Molecular Formula | C35H53BN6O6 |
| Molecular Weight | 664.66 g/mol |
| Exact Mass | 664.41 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1[C@H](C)C(=O)[C@@H](C)C(=O)O[C@H](CC)[C@@]2(C)OC(=O)N(CCCCn3cc(-c4cccc(N)c4)nn3)[C@@H]2[C@@H](C)NC[C@H](C)C[C@@]1(C)OC |
| InChI | InChI=1S/C35H53BN6O6/c1-9-28-35(7)31(24(5)38-19-21(2)18-34(6,46-8)30(36)22(3)29(43)23(4)32(44)47-28)42(33(45)48-35)16-11-10-15-41-20-27(39-40-41)25-13-12-14-26(37)17-25/h12-14,17,20-24,28,30-31,38H,9-11,15-16,18-19,37H2,1-8H3/t21-,22-,23-,24-,28-,30-,31-,34-,35-/m1/s1 |
| InChIKey | JMUPDVVNMBRUEM-WLVJRXJNSA-N |
| XLogP | 4.43 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|