C40H60BN7O10 — CID 140847921
CID 140847921 (PubChem CID 140847921) has the molecular formula C40H60BN7O10 and a molecular weight of 809.77 g/mol.
| Compound Name | CID 140847921 |
|---|---|
| PubChem CID | 140847921 |
| Molecular Formula | C40H60BN7O10 |
| Molecular Weight | 809.77 g/mol |
| Exact Mass | 809.45 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1[C@@H](C)C(=O)[C@@H](C)C(=O)O[C@H](CC)[C@@]2(C)OC(=O)N(CCCCn3cc(-c4cccc(N)c4)nn3)[C@@H]2[C@@H](CCN[C@@H](CC(=O)O)C(=O)O)NC[C@H](C)C[C@@]1(C)OC |
| InChI | InChI=1S/C40H60BN7O10/c1-8-31-40(6)35(48(38(55)58-40)17-10-9-16-47-22-30(45-46-47)26-12-11-13-27(42)18-26)28(14-15-43-29(36(52)53)19-32(49)50)44-21-23(2)20-39(5,56-7)34(41)24(3)33(51)25(4)37(54)57-31/h11-13,18,22-25,28-29,31,34-35,43-44H,8-10,14-17,19-21,42H2,1-7H3,(H,49,50)(H,52,53)/t23-,24+,25-,28-,29+,31-,34-,35-,39-,40-/m1/s1 |
| InChIKey | XZDDPIZTDZIGJL-YZSBEYQKSA-N |
| XLogP | 3.32 |
| TPSA | 237.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|