C30H44O6 — CID 11134884
(1S,2R,5R,6S,7E,10R,12S,13S,17R)-5-ethyl-2,6,10,12,15,15,17-heptamethyl-6-phenylmethoxy-4,14,16-trioxabicyclo[11.3.1]heptadec-7-ene-3,9-dione (PubChem CID 11134884) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is (1S,2R,5R,6S,7E,10R,12S,13S,17R)-5-ethyl-2,6,10,12,15,15,17-heptamethyl-6-phenylmethoxy-4,14,16-trioxabicyclo[11.3.1]heptadec-7-ene-3,9-dione.
| Compound Name | (1S,2R,5R,6S,7E,10R,12S,13S,17R)-5-ethyl-2,6,10,12,15,15,17-heptamethyl-6-phenylmethoxy-4,14,16-trioxabicyclo[11.3.1]heptadec-7-ene-3,9-dione |
|---|---|
| PubChem CID | 11134884 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (1S,2R,5R,6S,7E,10R,12S,13S,17R)-5-ethyl-2,6,10,12,15,15,17-heptamethyl-6-phenylmethoxy-4,14,16-trioxabicyclo[11.3.1]heptadec-7-ene-3,9-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@H]2OC(C)(C)O[C@H]([C@H]2C)[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@]1(C)OCc1ccccc1 |
| InChI | InChI=1S/C30H44O6/c1-9-25-30(8,33-18-23-13-11-10-12-14-23)16-15-24(31)19(2)17-20(3)26-21(4)27(22(5)28(32)34-25)36-29(6,7)35-26/h10-16,19-22,25-27H,9,17-18H2,1-8H3/b16-15+/t19-,20+,21-,22-,25-,26+,27+,30+/m1/s1 |
| InChIKey | XZLDEDKDGCDPAX-TVTKZNSJSA-N |
| XLogP | 5.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |