C28H42O6 — CID 24808045
(3R,4S,5S,6S,7S,9R,11E,13R,14R)-14-ethyl-4-hydroxy-6-[(4-methoxyphenyl)methoxy]-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,10-dione (PubChem CID 24808045) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is (3R,4S,5S,6S,7S,9R,11E,13R,14R)-14-ethyl-4-hydroxy-6-[(4-methoxyphenyl)methoxy]-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,10-dione.
| Compound Name | (3R,4S,5S,6S,7S,9R,11E,13R,14R)-14-ethyl-4-hydroxy-6-[(4-methoxyphenyl)methoxy]-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,10-dione |
|---|---|
| PubChem CID | 24808045 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (3R,4S,5S,6S,7S,9R,11E,13R,14R)-14-ethyl-4-hydroxy-6-[(4-methoxyphenyl)methoxy]-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](OCc2ccc(OC)cc2)[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@H]1C |
| InChI | InChI=1S/C28H42O6/c1-8-25-17(2)9-14-24(29)18(3)15-19(4)27(20(5)26(30)21(6)28(31)34-25)33-16-22-10-12-23(32-7)13-11-22/h9-14,17-21,25-27,30H,8,15-16H2,1-7H3/b14-9+/t17-,18-,19+,20+,21-,25-,26+,27+/m1/s1 |
| InChIKey | HMDFLAQUIKQRFT-HHZZCYIBSA-N |
| XLogP | 4.97 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |