C30H49NO8 — CID 57333188
[(2S,3R,4S,6R)-4-(dimethylamino)-2-[[(3R,5R,6S,7S,9R,11E,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-2,4,10-trioxo-1-oxacyclotetradec-11-en-6-yl]oxy]-6-methyloxan-3-yl] acetate (PubChem CID 57333188) has the molecular formula C30H49NO8 and a molecular weight of 551.72 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-4-(dimethylamino)-2-[[(3R,5R,6S,7S,9R,11E,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-2,4,10-trioxo-1-oxacyclotetradec-11-en-6-yl]oxy]-6-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,6R)-4-(dimethylamino)-2-[[(3R,5R,6S,7S,9R,11E,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-2,4,10-trioxo-1-oxacyclotetradec-11-en-6-yl]oxy]-6-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 57333188 |
| Molecular Formula | C30H49NO8 |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | [(2S,3R,4S,6R)-4-(dimethylamino)-2-[[(3R,5R,6S,7S,9R,11E,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-2,4,10-trioxo-1-oxacyclotetradec-11-en-6-yl]oxy]-6-methyloxan-3-yl] acetate |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2OC(C)=O)[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@H]1C |
| InChI | InChI=1S/C30H49NO8/c1-11-25-16(2)12-13-24(33)17(3)14-18(4)27(20(6)26(34)21(7)29(35)38-25)39-30-28(37-22(8)32)23(31(9)10)15-19(5)36-30/h12-13,16-21,23,25,27-28,30H,11,14-15H2,1-10H3/b13-12+/t16-,17-,18+,19-,20+,21-,23+,25-,27+,28-,30+/m1/s1 |
| InChIKey | YDZCJJHBQBAVIU-HREAUBODSA-N |
| XLogP | 3.97 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|