C27H45NO8 — CID 177405287
(3R,6R,7S,9R,11E,13R)-6-[(2S,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-14-ethyl-3,7,9,13-tetramethyl-1-oxacyclotetradec-11-ene-2,4,10-trione (PubChem CID 177405287) has the molecular formula C27H45NO8 and a molecular weight of 511.66 g/mol. Its IUPAC name is (3R,6R,7S,9R,11E,13R)-6-[(2S,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-14-ethyl-3,7,9,13-tetramethyl-1-oxacyclotetradec-11-ene-2,4,10-trione.
| Compound Name | (3R,6R,7S,9R,11E,13R)-6-[(2S,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-14-ethyl-3,7,9,13-tetramethyl-1-oxacyclotetradec-11-ene-2,4,10-trione |
|---|---|
| PubChem CID | 177405287 |
| Molecular Formula | C27H45NO8 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | (3R,6R,7S,9R,11E,13R)-6-[(2S,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-14-ethyl-3,7,9,13-tetramethyl-1-oxacyclotetradec-11-ene-2,4,10-trione |
| SMILES | CCC1OC(=O)[C@H](C)C(=O)C[C@@H](O[C@H]2O[C@H](C)[C@@H](O)[C@H](N(C)C)[C@H]2O)[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@H]1C |
| InChI | InChI=1S/C27H45NO8/c1-9-21-14(2)10-11-19(29)15(3)12-16(4)22(13-20(30)17(5)26(33)35-21)36-27-25(32)23(28(7)8)24(31)18(6)34-27/h10-11,14-18,21-25,27,31-32H,9,12-13H2,1-8H3/b11-10+/t14-,15-,16+,17-,18-,21?,22-,23+,24-,25-,27-/m1/s1 |
| InChIKey | HOKMNQIMMLRHJT-LPMSEYKASA-N |
| XLogP | 2.12 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|