C26H36O7 — CID 90320384
(1R,4R,5R,8R,9S,12R,14R)-5-ethyl-4-hydroxy-4,8,12,14-tetramethyl-9-phenylmethoxy-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione (PubChem CID 90320384) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is (1R,4R,5R,8R,9S,12R,14R)-5-ethyl-4-hydroxy-4,8,12,14-tetramethyl-9-phenylmethoxy-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione.
| Compound Name | (1R,4R,5R,8R,9S,12R,14R)-5-ethyl-4-hydroxy-4,8,12,14-tetramethyl-9-phenylmethoxy-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione |
|---|---|
| PubChem CID | 90320384 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (1R,4R,5R,8R,9S,12R,14R)-5-ethyl-4-hydroxy-4,8,12,14-tetramethyl-9-phenylmethoxy-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](OCc2ccccc2)CC(=O)[C@@]2(C)C[C@@H](C)[C@@H](CC(=O)[C@]1(C)O)O2 |
| InChI | InChI=1S/C26H36O7/c1-6-23-26(5,30)22(28)12-19-16(2)14-25(4,33-19)21(27)13-20(17(3)24(29)32-23)31-15-18-10-8-7-9-11-18/h7-11,16-17,19-20,23,30H,6,12-15H2,1-5H3/t16-,17-,19-,20+,23-,25-,26+/m1/s1 |
| InChIKey | HHLOZUUNDFAHSQ-CTZMDRAASA-N |
| XLogP | 3.40 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |