C34H44O6 — CID 90320409
(3R,4S,6R,7R,9R,10S,15R)-15-ethyl-6,7-dihydroxy-3,7,9,14-tetramethyl-4,10-bis(phenylmethoxy)-1-oxacyclopentadeca-11,12,13-trien-2-one (PubChem CID 90320409) has the molecular formula C34H44O6 and a molecular weight of 548.72 g/mol. Its IUPAC name is (3R,4S,6R,7R,9R,10S,15R)-15-ethyl-6,7-dihydroxy-3,7,9,14-tetramethyl-4,10-bis(phenylmethoxy)-1-oxacyclopentadeca-11,12,13-trien-2-one.
| Compound Name | (3R,4S,6R,7R,9R,10S,15R)-15-ethyl-6,7-dihydroxy-3,7,9,14-tetramethyl-4,10-bis(phenylmethoxy)-1-oxacyclopentadeca-11,12,13-trien-2-one |
|---|---|
| PubChem CID | 90320409 |
| Molecular Formula | C34H44O6 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | (3R,4S,6R,7R,9R,10S,15R)-15-ethyl-6,7-dihydroxy-3,7,9,14-tetramethyl-4,10-bis(phenylmethoxy)-1-oxacyclopentadeca-11,12,13-trien-2-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](OCc2ccccc2)C[C@@H](O)[C@](C)(O)C[C@@H](C)[C@H](OCc2ccccc2)C=C=C=C1C |
| InChI | InChI=1S/C34H44O6/c1-6-29-24(2)14-13-19-30(38-22-27-15-9-7-10-16-27)25(3)21-34(5,37)32(35)20-31(26(4)33(36)40-29)39-23-28-17-11-8-12-18-28/h7-12,15-19,25-26,29-32,35,37H,6,20-23H2,1-5H3/b24-19-/t25-,26-,29-,30-,31+,32-,34-/m1/s1 |
| InChIKey | NLWTWHXJHBYPKU-VANNNRSESA-N |
| XLogP | 5.91 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |