C34H40O5 — CID 123902190
(4E,7R,9R,10S,15R)-15-ethyl-3,7,9,14-tetramethyl-7,10-bis(phenylmethoxy)-1-oxacyclopentadeca-4,11,12,13-tetraene-2,6-dione (PubChem CID 123902190) has the molecular formula C34H40O5 and a molecular weight of 528.69 g/mol. Its IUPAC name is (4E,7R,9R,10S,15R)-15-ethyl-3,7,9,14-tetramethyl-7,10-bis(phenylmethoxy)-1-oxacyclopentadeca-4,11,12,13-tetraene-2,6-dione.
| Compound Name | (4E,7R,9R,10S,15R)-15-ethyl-3,7,9,14-tetramethyl-7,10-bis(phenylmethoxy)-1-oxacyclopentadeca-4,11,12,13-tetraene-2,6-dione |
|---|---|
| PubChem CID | 123902190 |
| Molecular Formula | C34H40O5 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | (4E,7R,9R,10S,15R)-15-ethyl-3,7,9,14-tetramethyl-7,10-bis(phenylmethoxy)-1-oxacyclopentadeca-4,11,12,13-tetraene-2,6-dione |
| SMILES | CC[C@H]1OC(=O)C(C)/C=C/C(=O)[C@](C)(OCc2ccccc2)C[C@@H](C)[C@H](OCc2ccccc2)C=C=C=C1C |
| InChI | InChI=1S/C34H40O5/c1-6-30-25(2)14-13-19-31(37-23-28-15-9-7-10-16-28)27(4)22-34(5,38-24-29-17-11-8-12-18-29)32(35)21-20-26(3)33(36)39-30/h7-12,15-21,26-27,30-31H,6,22-24H2,1-5H3/b21-20+,25-19-/t26?,27-,30-,31-,34-/m1/s1 |
| InChIKey | HUETXNQLTPHFDJ-RUKSRPRHSA-N |
| XLogP | 6.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |