C23H30NO5+ — CID 140620673
[(3S,6S,7S,8S,9S)-6,9-dimethyl-2-oxo-7,8-bis(phenylmethoxy)-1,5-dioxonan-3-yl]azanium (PubChem CID 140620673) has the molecular formula C23H30NO5+ and a molecular weight of 400.50 g/mol. Its IUPAC name is [(3S,6S,7S,8S,9S)-6,9-dimethyl-2-oxo-7,8-bis(phenylmethoxy)-1,5-dioxonan-3-yl]azanium.
| Compound Name | [(3S,6S,7S,8S,9S)-6,9-dimethyl-2-oxo-7,8-bis(phenylmethoxy)-1,5-dioxonan-3-yl]azanium |
|---|---|
| PubChem CID | 140620673 |
| Molecular Formula | C23H30NO5+ |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(3S,6S,7S,8S,9S)-6,9-dimethyl-2-oxo-7,8-bis(phenylmethoxy)-1,5-dioxonan-3-yl]azanium |
| SMILES | C[C@@H]1OC[C@H]([NH3+])C(=O)O[C@@H](C)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H29NO5/c1-16-21(27-13-18-9-5-3-6-10-18)22(28-14-19-11-7-4-8-12-19)17(2)29-23(25)20(24)15-26-16/h3-12,16-17,20-22H,13-15,24H2,1-2H3/p+1/t16-,17-,20-,21-,22-/m0/s1 |
| InChIKey | WRVBKZDUQLHQMF-NXQKYAITSA-O |
| XLogP | 2.12 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |